C15H17Br2NO — CID 43624854
N-[[5-(2,6-dibromo-4-methylphenyl)furan-2-yl]methyl]propan-1-amine (PubChem CID 43624854) has the molecular formula C15H17Br2NO and a molecular weight of 387.12 g/mol. Its IUPAC name is N-[[5-(2,6-dibromo-4-methylphenyl)furan-2-yl]methyl]propan-1-amine.
| Compound Name | N-[[5-(2,6-dibromo-4-methylphenyl)furan-2-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 43624854 |
| Molecular Formula | C15H17Br2NO |
| Molecular Weight | 387.12 g/mol |
| Exact Mass | 384.97 |
| IUPAC Name | N-[[5-(2,6-dibromo-4-methylphenyl)furan-2-yl]methyl]propan-1-amine |
| SMILES | CCCNCc1ccc(-c2c(Br)cc(C)cc2Br)o1 |
| InChI | InChI=1S/C15H17Br2NO/c1-3-6-18-9-11-4-5-14(19-11)15-12(16)7-10(2)8-13(15)17/h4-5,7-8,18H,3,6,9H2,1-2H3 |
| InChIKey | BCHUMSVGDATTFO-UHFFFAOYSA-N |
| XLogP | 5.28 |
| TPSA | 25.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.12 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|