C16H18ClN3S — CID 43625798
2-(4-chlorophenyl)-N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]ethanamine (PubChem CID 43625798) has the molecular formula C16H18ClN3S and a molecular weight of 319.86 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]ethanamine.
| Compound Name | 2-(4-chlorophenyl)-N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 43625798 |
| Molecular Formula | C16H18ClN3S |
| Molecular Weight | 319.86 g/mol |
| Exact Mass | 319.09 |
| IUPAC Name | 2-(4-chlorophenyl)-N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]ethanamine |
| SMILES | Cc1cn2c(CNCCc3ccc(Cl)cc3)c(C)nc2s1 |
| InChI | InChI=1S/C16H18ClN3S/c1-11-10-20-15(12(2)19-16(20)21-11)9-18-8-7-13-3-5-14(17)6-4-13/h3-6,10,18H,7-9H2,1-2H3 |
| InChIKey | ACUHKUPCIAGBSO-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 29.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.86 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|