C16H19N3OS — CID 61238024
4-[2-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]ethyl]phenol (PubChem CID 61238024) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is 4-[2-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]ethyl]phenol.
| Compound Name | 4-[2-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]ethyl]phenol |
|---|---|
| PubChem CID | 61238024 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 4-[2-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]ethyl]phenol |
| SMILES | Cc1cn2c(CNCCc3ccc(O)cc3)c(C)nc2s1 |
| InChI | InChI=1S/C16H19N3OS/c1-11-10-19-15(12(2)18-16(19)21-11)9-17-8-7-13-3-5-14(20)6-4-13/h3-6,10,17,20H,7-9H2,1-2H3 |
| InChIKey | DCBKSQYJFKIIQB-UHFFFAOYSA-N |
| XLogP | 3.05 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|