C14H23N3OS — CID 103924077
6-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]hexan-1-ol (PubChem CID 103924077) has the molecular formula C14H23N3OS and a molecular weight of 281.42 g/mol. Its IUPAC name is 6-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]hexan-1-ol.
| Compound Name | 6-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]hexan-1-ol |
|---|---|
| PubChem CID | 103924077 |
| Molecular Formula | C14H23N3OS |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 6-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methylamino]hexan-1-ol |
| SMILES | Cc1cn2c(CNCCCCCCO)c(C)nc2s1 |
| InChI | InChI=1S/C14H23N3OS/c1-11-10-17-13(12(2)16-14(17)19-11)9-15-7-5-3-4-6-8-18/h10,15,18H,3-9H2,1-2H3 |
| InChIKey | MWQPCDBEBBWXCY-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 49.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|