C11H17N3OS — CID 43625696
N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2-methoxyethanamine (PubChem CID 43625696) has the molecular formula C11H17N3OS and a molecular weight of 239.34 g/mol. Its IUPAC name is N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2-methoxyethanamine.
| Compound Name | N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2-methoxyethanamine |
|---|---|
| PubChem CID | 43625696 |
| Molecular Formula | C11H17N3OS |
| Molecular Weight | 239.34 g/mol |
| Exact Mass | 239.11 |
| IUPAC Name | N-[(2,6-dimethylimidazo[2,1-b][1,3]thiazol-5-yl)methyl]-2-methoxyethanamine |
| SMILES | COCCNCc1c(C)nc2sc(C)cn12 |
| InChI | InChI=1S/C11H17N3OS/c1-8-7-14-10(6-12-4-5-15-3)9(2)13-11(14)16-8/h7,12H,4-6H2,1-3H3 |
| InChIKey | ZFOUEBVODIDCRY-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.34 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|