C12H9N3O3S — CID 43629212
N-(4-cyanophenyl)-6-oxo-1H-pyridine-3-sulfonamide (PubChem CID 43629212) has the molecular formula C12H9N3O3S and a molecular weight of 275.29 g/mol. Its IUPAC name is N-(4-cyanophenyl)-6-oxo-1H-pyridine-3-sulfonamide.
| Compound Name | N-(4-cyanophenyl)-6-oxo-1H-pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 43629212 |
| Molecular Formula | C12H9N3O3S |
| Molecular Weight | 275.29 g/mol |
| Exact Mass | 275.04 |
| IUPAC Name | N-(4-cyanophenyl)-6-oxo-1H-pyridine-3-sulfonamide |
| SMILES | N#Cc1ccc(NS(=O)(=O)c2ccc(=O)[nH]c2)cc1 |
| InChI | InChI=1S/C12H9N3O3S/c13-7-9-1-3-10(4-2-9)15-19(17,18)11-5-6-12(16)14-8-11/h1-6,8,15H,(H,14,16) |
| InChIKey | HDWWPXNWBGNJKZ-UHFFFAOYSA-N |
| XLogP | 1.05 |
| TPSA | 102.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.29 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |