C14H19ClN2O3 — CID 43631782
2-[[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]amino]pentanoic acid (PubChem CID 43631782) has the molecular formula C14H19ClN2O3 and a molecular weight of 298.77 g/mol. Its IUPAC name is 2-[[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]amino]pentanoic acid.
| Compound Name | 2-[[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 43631782 |
| Molecular Formula | C14H19ClN2O3 |
| Molecular Weight | 298.77 g/mol |
| Exact Mass | 298.11 |
| IUPAC Name | 2-[[2-[(2-chlorophenyl)methylamino]-2-oxoethyl]amino]pentanoic acid |
| SMILES | CCCC(NCC(=O)NCc1ccccc1Cl)C(=O)O |
| InChI | InChI=1S/C14H19ClN2O3/c1-2-5-12(14(19)20)16-9-13(18)17-8-10-6-3-4-7-11(10)15/h3-4,6-7,12,16H,2,5,8-9H2,1H3,(H,17,18)(H,19,20) |
| InChIKey | ZMZYTBXFTBTIQM-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.77 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |