C13H16ClN — CID 43632516
3-(2-chlorophenyl)-N-prop-2-enylcyclobutan-1-amine (PubChem CID 43632516) has the molecular formula C13H16ClN and a molecular weight of 221.73 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-N-prop-2-enylcyclobutan-1-amine.
| Compound Name | 3-(2-chlorophenyl)-N-prop-2-enylcyclobutan-1-amine |
|---|---|
| PubChem CID | 43632516 |
| Molecular Formula | C13H16ClN |
| Molecular Weight | 221.73 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 3-(2-chlorophenyl)-N-prop-2-enylcyclobutan-1-amine |
| SMILES | C=CCNC1CC(c2ccccc2Cl)C1 |
| InChI | InChI=1S/C13H16ClN/c1-2-7-15-11-8-10(9-11)12-5-3-4-6-13(12)14/h2-6,10-11,15H,1,7-9H2 |
| InChIKey | YUOIDYLGNIGDGI-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.73 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|