C16H14BrCl2N — CID 43633020
N-[3-(2-bromophenyl)cyclobutyl]-2,4-dichloroaniline (PubChem CID 43633020) has the molecular formula C16H14BrCl2N and a molecular weight of 371.11 g/mol. Its IUPAC name is N-[3-(2-bromophenyl)cyclobutyl]-2,4-dichloroaniline.
| Compound Name | N-[3-(2-bromophenyl)cyclobutyl]-2,4-dichloroaniline |
|---|---|
| PubChem CID | 43633020 |
| Molecular Formula | C16H14BrCl2N |
| Molecular Weight | 371.11 g/mol |
| Exact Mass | 368.97 |
| IUPAC Name | N-[3-(2-bromophenyl)cyclobutyl]-2,4-dichloroaniline |
| SMILES | Clc1ccc(NC2CC(c3ccccc3Br)C2)c(Cl)c1 |
| InChI | InChI=1S/C16H14BrCl2N/c17-14-4-2-1-3-13(14)10-7-12(8-10)20-16-6-5-11(18)9-15(16)19/h1-6,9-10,12,20H,7-8H2 |
| InChIKey | QVZDRVXIVWRXLO-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.11 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |