C16H13Br4N — CID 63425206
2,4,6-tribromo-N-[3-(2-bromophenyl)cyclobutyl]aniline (PubChem CID 63425206) has the molecular formula C16H13Br4N and a molecular weight of 538.90 g/mol. Its IUPAC name is 2,4,6-tribromo-N-[3-(2-bromophenyl)cyclobutyl]aniline.
| Compound Name | 2,4,6-tribromo-N-[3-(2-bromophenyl)cyclobutyl]aniline |
|---|---|
| PubChem CID | 63425206 |
| Molecular Formula | C16H13Br4N |
| Molecular Weight | 538.90 g/mol |
| Exact Mass | 534.78 |
| IUPAC Name | 2,4,6-tribromo-N-[3-(2-bromophenyl)cyclobutyl]aniline |
| SMILES | Brc1cc(Br)c(NC2CC(c3ccccc3Br)C2)c(Br)c1 |
| InChI | InChI=1S/C16H13Br4N/c17-10-7-14(19)16(15(20)8-10)21-11-5-9(6-11)12-3-1-2-4-13(12)18/h1-4,7-9,11,21H,5-6H2 |
| InChIKey | GOOKPNLDRGLCNT-UHFFFAOYSA-N |
| XLogP | 7.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.90 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |