C16H14BrF2N — CID 43633363
N-[3-(3-bromophenyl)cyclobutyl]-3,4-difluoroaniline (PubChem CID 43633363) has the molecular formula C16H14BrF2N and a molecular weight of 338.20 g/mol. Its IUPAC name is N-[3-(3-bromophenyl)cyclobutyl]-3,4-difluoroaniline.
| Compound Name | N-[3-(3-bromophenyl)cyclobutyl]-3,4-difluoroaniline |
|---|---|
| PubChem CID | 43633363 |
| Molecular Formula | C16H14BrF2N |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | N-[3-(3-bromophenyl)cyclobutyl]-3,4-difluoroaniline |
| SMILES | Fc1ccc(NC2CC(c3cccc(Br)c3)C2)cc1F |
| InChI | InChI=1S/C16H14BrF2N/c17-12-3-1-2-10(6-12)11-7-14(8-11)20-13-4-5-15(18)16(19)9-13/h1-6,9,11,14,20H,7-8H2 |
| InChIKey | YIURXBWUJVHZKS-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |