C13H14IN3O — CID 43643246
4-amino-1-ethyl-N-(3-iodophenyl)pyrrole-2-carboxamide (PubChem CID 43643246) has the molecular formula C13H14IN3O and a molecular weight of 355.18 g/mol. Its IUPAC name is 4-amino-1-ethyl-N-(3-iodophenyl)pyrrole-2-carboxamide.
| Compound Name | 4-amino-1-ethyl-N-(3-iodophenyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 43643246 |
| Molecular Formula | C13H14IN3O |
| Molecular Weight | 355.18 g/mol |
| Exact Mass | 355.02 |
| IUPAC Name | 4-amino-1-ethyl-N-(3-iodophenyl)pyrrole-2-carboxamide |
| SMILES | CCn1cc(N)cc1C(=O)Nc1cccc(I)c1 |
| InChI | InChI=1S/C13H14IN3O/c1-2-17-8-10(15)7-12(17)13(18)16-11-5-3-4-9(14)6-11/h3-8H,2,15H2,1H3,(H,16,18) |
| InChIKey | OZDQJKKLSXDOPK-UHFFFAOYSA-N |
| XLogP | 2.95 |
| TPSA | 60.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.18 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|