C13H12BrNO2S — CID 43646965
N-[(5-bromothiophen-3-yl)methyl]-2,3-dihydro-1,4-benzodioxin-6-amine (PubChem CID 43646965) has the molecular formula C13H12BrNO2S and a molecular weight of 326.22 g/mol. Its IUPAC name is N-[(5-bromothiophen-3-yl)methyl]-2,3-dihydro-1,4-benzodioxin-6-amine.
| Compound Name | N-[(5-bromothiophen-3-yl)methyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
|---|---|
| PubChem CID | 43646965 |
| Molecular Formula | C13H12BrNO2S |
| Molecular Weight | 326.22 g/mol |
| Exact Mass | 324.98 |
| IUPAC Name | N-[(5-bromothiophen-3-yl)methyl]-2,3-dihydro-1,4-benzodioxin-6-amine |
| SMILES | Brc1cc(CNc2ccc3c(c2)OCCO3)cs1 |
| InChI | InChI=1S/C13H12BrNO2S/c14-13-5-9(8-18-13)7-15-10-1-2-11-12(6-10)17-4-3-16-11/h1-2,5-6,8,15H,3-4,7H2 |
| InChIKey | DIISNBFHSKTEAR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.22 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|