C8H14N4O — CID 43647536
2-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]acetamide (PubChem CID 43647536) has the molecular formula C8H14N4O and a molecular weight of 182.23 g/mol. Its IUPAC name is 2-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]acetamide.
| Compound Name | 2-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]acetamide |
|---|---|
| PubChem CID | 43647536 |
| Molecular Formula | C8H14N4O |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.12 |
| IUPAC Name | 2-[4-(aminomethyl)-3,5-dimethylpyrazol-1-yl]acetamide |
| SMILES | Cc1nn(CC(N)=O)c(C)c1CN |
| InChI | InChI=1S/C8H14N4O/c1-5-7(3-9)6(2)12(11-5)4-8(10)13/h3-4,9H2,1-2H3,(H2,10,13) |
| InChIKey | VPCNODYJNFWIAC-UHFFFAOYSA-N |
| XLogP | -0.56 |
| TPSA | 86.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |