C12H22N2O3S — CID 43648898
N-(1,1-dioxothiolan-3-yl)-N-methyl-2-piperidin-2-ylacetamide (PubChem CID 43648898) has the molecular formula C12H22N2O3S and a molecular weight of 274.39 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-methyl-2-piperidin-2-ylacetamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-2-piperidin-2-ylacetamide |
|---|---|
| PubChem CID | 43648898 |
| Molecular Formula | C12H22N2O3S |
| Molecular Weight | 274.39 g/mol |
| Exact Mass | 274.14 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-methyl-2-piperidin-2-ylacetamide |
| SMILES | CN(C(=O)CC1CCCCN1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C12H22N2O3S/c1-14(11-5-7-18(16,17)9-11)12(15)8-10-4-2-3-6-13-10/h10-11,13H,2-9H2,1H3 |
| InChIKey | XFIADVZZKNOUBP-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.39 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |