C13H19N3O4S — CID 43649007
(E)-3-[5-[(1,1-dioxothiolan-3-yl)-methylamino]-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid (PubChem CID 43649007) has the molecular formula C13H19N3O4S and a molecular weight of 313.38 g/mol. Its IUPAC name is (E)-3-[5-[(1,1-dioxothiolan-3-yl)-methylamino]-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid.
| Compound Name | (E)-3-[5-[(1,1-dioxothiolan-3-yl)-methylamino]-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid |
|---|---|
| PubChem CID | 43649007 |
| Molecular Formula | C13H19N3O4S |
| Molecular Weight | 313.38 g/mol |
| Exact Mass | 313.11 |
| IUPAC Name | (E)-3-[5-[(1,1-dioxothiolan-3-yl)-methylamino]-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid |
| SMILES | Cc1nn(C)c(N(C)C2CCS(=O)(=O)C2)c1/C=C/C(=O)O |
| InChI | InChI=1S/C13H19N3O4S/c1-9-11(4-5-12(17)18)13(16(3)14-9)15(2)10-6-7-21(19,20)8-10/h4-5,10H,6-8H2,1-3H3,(H,17,18)/b5-4+ |
| InChIKey | XUQVGSUVYJDPJQ-SNAWJCMRSA-N |
| XLogP | 0.45 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.38 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|