About 3-[5-(N,2-dimethylanilino)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid
3-[5-(N,2-dimethylanilino)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid (PubChem CID 76931131) has the molecular formula C16H19N3O2
and a molecular weight of 285.35 g/mol. Its IUPAC name is 3-[5-(N,2-dimethylanilino)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid.
Molecular Properties
| Compound Name | 3-[5-(N,2-dimethylanilino)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid |
| PubChem CID | 76931131 |
| Molecular Formula | C16H19N3O2 |
| Molecular Weight | 285.35 g/mol |
| Exact Mass | 285.15 |
| IUPAC Name | 3-[5-(N,2-dimethylanilino)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid |
| SMILES | Cc1ccccc1N(C)c1c(C=CC(=O)O)c(C)nn1C |
| InChI | InChI=1S/C16H19N3O2/c1-11-7-5-6-8-14(11)18(3)16-13(9-10-15(20)21)12(2)17-19(16)4/h5-10H,1-4H3,(H,20,21) |
| InChIKey | QEUZBRWBGNRHGP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.35 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3-[5-(N,2-dimethylanilino)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[5-(N,2-dimethylanilino)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid?
The IUPAC name of 3-[5-(N,2-dimethylanilino)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid (CID 76931131) is 3-[5-(N,2-dimethylanilino)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid.
What is the SMILES notation for 3-[5-(N,2-dimethylanilino)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid?
The canonical SMILES for 3-[5-(N,2-dimethylanilino)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid is Cc1ccccc1N(C)c1c(C=CC(=O)O)c(C)nn1C.
What is the InChIKey of 3-[5-(N,2-dimethylanilino)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid?
The InChIKey is QEUZBRWBGNRHGP-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H19N3O2/c1-11-7-5-6-8-14(11)18(3)16-13(9-10-15(20)21)12(2)17-19(16)4/h5-10H,1-4H3,(H,20,21).
What are the key properties of 3-[5-(N,2-dimethylanilino)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid?
3-[5-(N,2-dimethylanilino)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid has a molecular weight of 285.35 g/mol, XLogP of 2.90, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[5-(N,2-dimethylanilino)-1,3-dimethylpyrazol-4-yl]prop-2-enoic acid is sourced from PubChem (CID 76931131), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).