C9H9NO4S — CID 43649080
5-[(2-oxo-1,3-thiazolidin-3-yl)methyl]furan-2-carboxylic acid (PubChem CID 43649080) has the molecular formula C9H9NO4S and a molecular weight of 227.24 g/mol. Its IUPAC name is 5-[(2-oxo-1,3-thiazolidin-3-yl)methyl]furan-2-carboxylic acid.
| Compound Name | 5-[(2-oxo-1,3-thiazolidin-3-yl)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 43649080 |
| Molecular Formula | C9H9NO4S |
| Molecular Weight | 227.24 g/mol |
| Exact Mass | 227.03 |
| IUPAC Name | 5-[(2-oxo-1,3-thiazolidin-3-yl)methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CN2CCSC2=O)o1 |
| InChI | InChI=1S/C9H9NO4S/c11-8(12)7-2-1-6(14-7)5-10-3-4-15-9(10)13/h1-2H,3-5H2,(H,11,12) |
| InChIKey | YSJZKGQHBLGLRM-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 70.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.24 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|