5-[(3,5-dioxomorpholin-4-yl)methyl]furan-2-carboxylic acid

C10H9NO6 — CID 61313696

IUPAC5-[(3,5-dioxomorpholin-4-yl)methyl]furan-2-carboxylic acid
SMILESO=C(O)c1ccc(CN2C(=O)COCC2=O)o1
InChIInChI=1S/C10H9NO6/c12-8-4-16-5-9(13)11(8)3-6-1-2-7(17-6)10(14)15/h1-2H,3-5H2,(H,14,15)
InChIKeyYQVCIPFWGAVXBP-UHFFFAOYSA-N
MW239.18 g/mol
LogP-0.14
Rot. Bonds3

About 5-[(3,5-dioxomorpholin-4-yl)methyl]furan-2-carboxylic acid

5-[(3,5-dioxomorpholin-4-yl)methyl]furan-2-carboxylic acid (PubChem CID 61313696) has the molecular formula C10H9NO6 and a molecular weight of 239.18 g/mol. Its IUPAC name is 5-[(3,5-dioxomorpholin-4-yl)methyl]furan-2-carboxylic acid.

Molecular Properties

Compound Name5-[(3,5-dioxomorpholin-4-yl)methyl]furan-2-carboxylic acid
PubChem CID61313696
Molecular FormulaC10H9NO6
Molecular Weight239.18 g/mol
Exact Mass239.04
IUPAC Name5-[(3,5-dioxomorpholin-4-yl)methyl]furan-2-carboxylic acid
SMILESO=C(O)c1ccc(CN2C(=O)COCC2=O)o1
InChIInChI=1S/C10H9NO6/c12-8-4-16-5-9(13)11(8)3-6-1-2-7(17-6)10(14)15/h1-2H,3-5H2,(H,14,15)
InChIKeyYQVCIPFWGAVXBP-UHFFFAOYSA-N
XLogP-0.14
TPSA97.05 Ų
H-Bond Donors1
H-Bond Acceptors5
Rotatable Bonds3
Heavy Atoms17
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500239.18
LogP ≤ 5-0.14
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'phthalimide', 'substructure': 'N/A'}

Analyze 5-[(3,5-dioxomorpholin-4-yl)methyl]furan-2-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 5-[(3,5-dioxomorpholin-4-yl)methyl]furan-2-carboxylic acid?
The IUPAC name of 5-[(3,5-dioxomorpholin-4-yl)methyl]furan-2-carboxylic acid (CID 61313696) is 5-[(3,5-dioxomorpholin-4-yl)methyl]furan-2-carboxylic acid.
What is the SMILES notation for 5-[(3,5-dioxomorpholin-4-yl)methyl]furan-2-carboxylic acid?
The canonical SMILES for 5-[(3,5-dioxomorpholin-4-yl)methyl]furan-2-carboxylic acid is O=C(O)c1ccc(CN2C(=O)COCC2=O)o1.
What is the InChIKey of 5-[(3,5-dioxomorpholin-4-yl)methyl]furan-2-carboxylic acid?
The InChIKey is YQVCIPFWGAVXBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9NO6/c12-8-4-16-5-9(13)11(8)3-6-1-2-7(17-6)10(14)15/h1-2H,3-5H2,(H,14,15).
What are the key properties of 5-[(3,5-dioxomorpholin-4-yl)methyl]furan-2-carboxylic acid?
5-[(3,5-dioxomorpholin-4-yl)methyl]furan-2-carboxylic acid has a molecular weight of 239.18 g/mol, XLogP of -0.14, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-[(3,5-dioxomorpholin-4-yl)methyl]furan-2-carboxylic acid is sourced from PubChem (CID 61313696), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).