C10H9NO6 — CID 61313696
5-[(3,5-dioxomorpholin-4-yl)methyl]furan-2-carboxylic acid (PubChem CID 61313696) has the molecular formula C10H9NO6 and a molecular weight of 239.18 g/mol. Its IUPAC name is 5-[(3,5-dioxomorpholin-4-yl)methyl]furan-2-carboxylic acid.
| Compound Name | 5-[(3,5-dioxomorpholin-4-yl)methyl]furan-2-carboxylic acid |
|---|---|
| PubChem CID | 61313696 |
| Molecular Formula | C10H9NO6 |
| Molecular Weight | 239.18 g/mol |
| Exact Mass | 239.04 |
| IUPAC Name | 5-[(3,5-dioxomorpholin-4-yl)methyl]furan-2-carboxylic acid |
| SMILES | O=C(O)c1ccc(CN2C(=O)COCC2=O)o1 |
| InChI | InChI=1S/C10H9NO6/c12-8-4-16-5-9(13)11(8)3-6-1-2-7(17-6)10(14)15/h1-2H,3-5H2,(H,14,15) |
| InChIKey | YQVCIPFWGAVXBP-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 97.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.18 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|