C14H15F2N3 — CID 43650985
3-[5-(2,6-difluorophenyl)-1H-imidazol-2-yl]piperidine (PubChem CID 43650985) has the molecular formula C14H15F2N3 and a molecular weight of 263.29 g/mol. Its IUPAC name is 3-[5-(2,6-difluorophenyl)-1H-imidazol-2-yl]piperidine.
| Compound Name | 3-[5-(2,6-difluorophenyl)-1H-imidazol-2-yl]piperidine |
|---|---|
| PubChem CID | 43650985 |
| Molecular Formula | C14H15F2N3 |
| Molecular Weight | 263.29 g/mol |
| Exact Mass | 263.12 |
| IUPAC Name | 3-[5-(2,6-difluorophenyl)-1H-imidazol-2-yl]piperidine |
| SMILES | Fc1cccc(F)c1-c1cnc(C2CCCNC2)[nH]1 |
| InChI | InChI=1S/C14H15F2N3/c15-10-4-1-5-11(16)13(10)12-8-18-14(19-12)9-3-2-6-17-7-9/h1,4-5,8-9,17H,2-3,6-7H2,(H,18,19) |
| InChIKey | LXSHJKPWZUSQNB-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.29 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |