C16H21N3 — CID 43651094
2-[5-(2,4-dimethylphenyl)-1H-imidazol-2-yl]piperidine (PubChem CID 43651094) has the molecular formula C16H21N3 and a molecular weight of 255.37 g/mol. Its IUPAC name is 2-[5-(2,4-dimethylphenyl)-1H-imidazol-2-yl]piperidine.
| Compound Name | 2-[5-(2,4-dimethylphenyl)-1H-imidazol-2-yl]piperidine |
|---|---|
| PubChem CID | 43651094 |
| Molecular Formula | C16H21N3 |
| Molecular Weight | 255.37 g/mol |
| Exact Mass | 255.17 |
| IUPAC Name | 2-[5-(2,4-dimethylphenyl)-1H-imidazol-2-yl]piperidine |
| SMILES | Cc1ccc(-c2cnc(C3CCCCN3)[nH]2)c(C)c1 |
| InChI | InChI=1S/C16H21N3/c1-11-6-7-13(12(2)9-11)15-10-18-16(19-15)14-5-3-4-8-17-14/h6-7,9-10,14,17H,3-5,8H2,1-2H3,(H,18,19) |
| InChIKey | JLGNETKZIQVDPU-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.37 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |