C12H23N3 — CID 43651212
5-(5-tert-butyl-1H-imidazol-2-yl)pentan-1-amine (PubChem CID 43651212) has the molecular formula C12H23N3 and a molecular weight of 209.34 g/mol. Its IUPAC name is 5-(5-tert-butyl-1H-imidazol-2-yl)pentan-1-amine.
| Compound Name | 5-(5-tert-butyl-1H-imidazol-2-yl)pentan-1-amine |
|---|---|
| PubChem CID | 43651212 |
| Molecular Formula | C12H23N3 |
| Molecular Weight | 209.34 g/mol |
| Exact Mass | 209.19 |
| IUPAC Name | 5-(5-tert-butyl-1H-imidazol-2-yl)pentan-1-amine |
| SMILES | CC(C)(C)c1cnc(CCCCCN)[nH]1 |
| InChI | InChI=1S/C12H23N3/c1-12(2,3)10-9-14-11(15-10)7-5-4-6-8-13/h9H,4-8,13H2,1-3H3,(H,14,15) |
| InChIKey | GGAMPDDLYUEJML-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.34 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|