C8H12F3N3O2S — CID 43651679
3-methylsulfonyl-1-[5-(trifluoromethyl)-1H-imidazol-2-yl]propan-1-amine (PubChem CID 43651679) has the molecular formula C8H12F3N3O2S and a molecular weight of 271.26 g/mol. Its IUPAC name is 3-methylsulfonyl-1-[5-(trifluoromethyl)-1H-imidazol-2-yl]propan-1-amine.
| Compound Name | 3-methylsulfonyl-1-[5-(trifluoromethyl)-1H-imidazol-2-yl]propan-1-amine |
|---|---|
| PubChem CID | 43651679 |
| Molecular Formula | C8H12F3N3O2S |
| Molecular Weight | 271.26 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 3-methylsulfonyl-1-[5-(trifluoromethyl)-1H-imidazol-2-yl]propan-1-amine |
| SMILES | CS(=O)(=O)CCC(N)c1ncc(C(F)(F)F)[nH]1 |
| InChI | InChI=1S/C8H12F3N3O2S/c1-17(15,16)3-2-5(12)7-13-4-6(14-7)8(9,10)11/h4-5H,2-3,12H2,1H3,(H,13,14) |
| InChIKey | PGJASFRZBWXXSF-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.26 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |