C13H16FN3O2S — CID 43651692
1-[5-(2-fluorophenyl)-1H-imidazol-2-yl]-3-methylsulfonylpropan-1-amine (PubChem CID 43651692) has the molecular formula C13H16FN3O2S and a molecular weight of 297.35 g/mol. Its IUPAC name is 1-[5-(2-fluorophenyl)-1H-imidazol-2-yl]-3-methylsulfonylpropan-1-amine.
| Compound Name | 1-[5-(2-fluorophenyl)-1H-imidazol-2-yl]-3-methylsulfonylpropan-1-amine |
|---|---|
| PubChem CID | 43651692 |
| Molecular Formula | C13H16FN3O2S |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.09 |
| IUPAC Name | 1-[5-(2-fluorophenyl)-1H-imidazol-2-yl]-3-methylsulfonylpropan-1-amine |
| SMILES | CS(=O)(=O)CCC(N)c1ncc(-c2ccccc2F)[nH]1 |
| InChI | InChI=1S/C13H16FN3O2S/c1-20(18,19)7-6-11(15)13-16-8-12(17-13)9-4-2-3-5-10(9)14/h2-5,8,11H,6-7,15H2,1H3,(H,16,17) |
| InChIKey | XWNVNGVVUOGKEV-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 88.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |