C13H12FN3O2S2 — CID 43657764
3-fluoro-4-(3-sulfamoylanilino)benzenecarbothioamide (PubChem CID 43657764) has the molecular formula C13H12FN3O2S2 and a molecular weight of 325.39 g/mol. Its IUPAC name is 3-fluoro-4-(3-sulfamoylanilino)benzenecarbothioamide.
| Compound Name | 3-fluoro-4-(3-sulfamoylanilino)benzenecarbothioamide |
|---|---|
| PubChem CID | 43657764 |
| Molecular Formula | C13H12FN3O2S2 |
| Molecular Weight | 325.39 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 3-fluoro-4-(3-sulfamoylanilino)benzenecarbothioamide |
| SMILES | NC(=S)c1ccc(Nc2cccc(S(N)(=O)=O)c2)c(F)c1 |
| InChI | InChI=1S/C13H12FN3O2S2/c14-11-6-8(13(15)20)4-5-12(11)17-9-2-1-3-10(7-9)21(16,18)19/h1-7,17H,(H2,15,20)(H2,16,18,19) |
| InChIKey | LUCCHQQSJVERLY-UHFFFAOYSA-N |
| XLogP | 1.85 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.39 |
| LogP ≤ 5 | 1.85 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|