C14H15N3O2S2 — CID 107928403
5-methyl-2-(3-sulfamoylanilino)benzenecarbothioamide (PubChem CID 107928403) has the molecular formula C14H15N3O2S2 and a molecular weight of 321.43 g/mol. Its IUPAC name is 5-methyl-2-(3-sulfamoylanilino)benzenecarbothioamide.
| Compound Name | 5-methyl-2-(3-sulfamoylanilino)benzenecarbothioamide |
|---|---|
| PubChem CID | 107928403 |
| Molecular Formula | C14H15N3O2S2 |
| Molecular Weight | 321.43 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 5-methyl-2-(3-sulfamoylanilino)benzenecarbothioamide |
| SMILES | Cc1ccc(Nc2cccc(S(N)(=O)=O)c2)c(C(N)=S)c1 |
| InChI | InChI=1S/C14H15N3O2S2/c1-9-5-6-13(12(7-9)14(15)20)17-10-3-2-4-11(8-10)21(16,18)19/h2-8,17H,1H3,(H2,15,20)(H2,16,18,19) |
| InChIKey | OIMGFZSMQLHEDV-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 98.21 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.43 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|