C13H16FN3O — CID 43662119
5-fluoro-1-[1-(oxolan-2-yl)ethyl]benzimidazol-2-amine (PubChem CID 43662119) has the molecular formula C13H16FN3O and a molecular weight of 249.29 g/mol. Its IUPAC name is 5-fluoro-1-[1-(oxolan-2-yl)ethyl]benzimidazol-2-amine.
| Compound Name | 5-fluoro-1-[1-(oxolan-2-yl)ethyl]benzimidazol-2-amine |
|---|---|
| PubChem CID | 43662119 |
| Molecular Formula | C13H16FN3O |
| Molecular Weight | 249.29 g/mol |
| Exact Mass | 249.13 |
| IUPAC Name | 5-fluoro-1-[1-(oxolan-2-yl)ethyl]benzimidazol-2-amine |
| SMILES | CC(C1CCCO1)n1c(N)nc2cc(F)ccc21 |
| InChI | InChI=1S/C13H16FN3O/c1-8(12-3-2-6-18-12)17-11-5-4-9(14)7-10(11)16-13(17)15/h4-5,7-8,12H,2-3,6H2,1H3,(H2,15,16) |
| InChIKey | NUDWBVBJUBPIMV-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.29 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |