C16H21ClN2O — CID 43667623
2-(1-chloroethyl)-5-methyl-1-[1-(oxolan-2-yl)ethyl]benzimidazole (PubChem CID 43667623) has the molecular formula C16H21ClN2O and a molecular weight of 292.81 g/mol. Its IUPAC name is 2-(1-chloroethyl)-5-methyl-1-[1-(oxolan-2-yl)ethyl]benzimidazole.
| Compound Name | 2-(1-chloroethyl)-5-methyl-1-[1-(oxolan-2-yl)ethyl]benzimidazole |
|---|---|
| PubChem CID | 43667623 |
| Molecular Formula | C16H21ClN2O |
| Molecular Weight | 292.81 g/mol |
| Exact Mass | 292.13 |
| IUPAC Name | 2-(1-chloroethyl)-5-methyl-1-[1-(oxolan-2-yl)ethyl]benzimidazole |
| SMILES | Cc1ccc2c(c1)nc(C(C)Cl)n2C(C)C1CCCO1 |
| InChI | InChI=1S/C16H21ClN2O/c1-10-6-7-14-13(9-10)18-16(11(2)17)19(14)12(3)15-5-4-8-20-15/h6-7,9,11-12,15H,4-5,8H2,1-3H3 |
| InChIKey | XCHKLGHYQWMMFO-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.81 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|