C10H8F3N3S — CID 43663832
N-(thiadiazol-4-ylmethyl)-3-(trifluoromethyl)aniline (PubChem CID 43663832) has the molecular formula C10H8F3N3S and a molecular weight of 259.26 g/mol. Its IUPAC name is N-(thiadiazol-4-ylmethyl)-3-(trifluoromethyl)aniline.
| Compound Name | N-(thiadiazol-4-ylmethyl)-3-(trifluoromethyl)aniline |
|---|---|
| PubChem CID | 43663832 |
| Molecular Formula | C10H8F3N3S |
| Molecular Weight | 259.26 g/mol |
| Exact Mass | 259.04 |
| IUPAC Name | N-(thiadiazol-4-ylmethyl)-3-(trifluoromethyl)aniline |
| SMILES | FC(F)(F)c1cccc(NCc2csnn2)c1 |
| InChI | InChI=1S/C10H8F3N3S/c11-10(12,13)7-2-1-3-8(4-7)14-5-9-6-17-16-15-9/h1-4,6,14H,5H2 |
| InChIKey | TXRVOAZWRRKKNG-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 37.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.26 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |