C14H17ClN2 — CID 43667459
2-(1-chloroethyl)-1-(cyclobutylmethyl)benzimidazole (PubChem CID 43667459) has the molecular formula C14H17ClN2 and a molecular weight of 248.76 g/mol. Its IUPAC name is 2-(1-chloroethyl)-1-(cyclobutylmethyl)benzimidazole.
| Compound Name | 2-(1-chloroethyl)-1-(cyclobutylmethyl)benzimidazole |
|---|---|
| PubChem CID | 43667459 |
| Molecular Formula | C14H17ClN2 |
| Molecular Weight | 248.76 g/mol |
| Exact Mass | 248.11 |
| IUPAC Name | 2-(1-chloroethyl)-1-(cyclobutylmethyl)benzimidazole |
| SMILES | CC(Cl)c1nc2ccccc2n1CC1CCC1 |
| InChI | InChI=1S/C14H17ClN2/c1-10(15)14-16-12-7-2-3-8-13(12)17(14)9-11-5-4-6-11/h2-3,7-8,10-11H,4-6,9H2,1H3 |
| InChIKey | WIKXHBIUQWQEJM-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.76 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|