C16H20Cl2N2 — CID 43667498
7-chloro-2-(2-chloroethyl)-1-(3-methylcyclohexyl)benzimidazole (PubChem CID 43667498) has the molecular formula C16H20Cl2N2 and a molecular weight of 311.26 g/mol. Its IUPAC name is 7-chloro-2-(2-chloroethyl)-1-(3-methylcyclohexyl)benzimidazole.
| Compound Name | 7-chloro-2-(2-chloroethyl)-1-(3-methylcyclohexyl)benzimidazole |
|---|---|
| PubChem CID | 43667498 |
| Molecular Formula | C16H20Cl2N2 |
| Molecular Weight | 311.26 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | 7-chloro-2-(2-chloroethyl)-1-(3-methylcyclohexyl)benzimidazole |
| SMILES | CC1CCCC(n2c(CCCl)nc3cccc(Cl)c32)C1 |
| InChI | InChI=1S/C16H20Cl2N2/c1-11-4-2-5-12(10-11)20-15(8-9-17)19-14-7-3-6-13(18)16(14)20/h3,6-7,11-12H,2,4-5,8-10H2,1H3 |
| InChIKey | RAKMOHFLSNSDFZ-UHFFFAOYSA-N |
| XLogP | 5.22 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.26 |
| LogP ≤ 5 | 5.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|