C17H21N3S — CID 43669619
4-(azocan-1-yl)quinoline-3-carbothioamide (PubChem CID 43669619) has the molecular formula C17H21N3S and a molecular weight of 299.44 g/mol. Its IUPAC name is 4-(azocan-1-yl)quinoline-3-carbothioamide.
| Compound Name | 4-(azocan-1-yl)quinoline-3-carbothioamide |
|---|---|
| PubChem CID | 43669619 |
| Molecular Formula | C17H21N3S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 4-(azocan-1-yl)quinoline-3-carbothioamide |
| SMILES | NC(=S)c1cnc2ccccc2c1N1CCCCCCC1 |
| InChI | InChI=1S/C17H21N3S/c18-17(21)14-12-19-15-9-5-4-8-13(15)16(14)20-10-6-2-1-3-7-11-20/h4-5,8-9,12H,1-3,6-7,10-11H2,(H2,18,21) |
| InChIKey | DOYIILSTORDIAS-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 42.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|