C16H19N3OS — CID 43669671
4-(2,5-dimethylmorpholin-4-yl)quinoline-3-carbothioamide (PubChem CID 43669671) has the molecular formula C16H19N3OS and a molecular weight of 301.42 g/mol. Its IUPAC name is 4-(2,5-dimethylmorpholin-4-yl)quinoline-3-carbothioamide.
| Compound Name | 4-(2,5-dimethylmorpholin-4-yl)quinoline-3-carbothioamide |
|---|---|
| PubChem CID | 43669671 |
| Molecular Formula | C16H19N3OS |
| Molecular Weight | 301.42 g/mol |
| Exact Mass | 301.12 |
| IUPAC Name | 4-(2,5-dimethylmorpholin-4-yl)quinoline-3-carbothioamide |
| SMILES | CC1CN(c2c(C(N)=S)cnc3ccccc23)C(C)CO1 |
| InChI | InChI=1S/C16H19N3OS/c1-10-9-20-11(2)8-19(10)15-12-5-3-4-6-14(12)18-7-13(15)16(17)21/h3-7,10-11H,8-9H2,1-2H3,(H2,17,21) |
| InChIKey | BFLWXCCUGUYVHA-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 51.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 301.42 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|