C12H10N6 — CID 43669845
4-(1,2,4-triazol-1-yl)quinoline-3-carboximidamide (PubChem CID 43669845) has the molecular formula C12H10N6 and a molecular weight of 238.25 g/mol. Its IUPAC name is 4-(1,2,4-triazol-1-yl)quinoline-3-carboximidamide.
| Compound Name | 4-(1,2,4-triazol-1-yl)quinoline-3-carboximidamide |
|---|---|
| PubChem CID | 43669845 |
| Molecular Formula | C12H10N6 |
| Molecular Weight | 238.25 g/mol |
| Exact Mass | 238.10 |
| IUPAC Name | 4-(1,2,4-triazol-1-yl)quinoline-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1cnc2ccccc2c1-n1cncn1 |
| InChI | InChI=1S/C12H10N6/c13-12(14)9-5-16-10-4-2-1-3-8(10)11(9)18-7-15-6-17-18/h1-7H,(H3,13,14) |
| InChIKey | HUXHTLXJAHIIDC-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 93.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.25 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|