C14H16F2N4O — CID 107480189
4-[2,2-difluoroethyl(2-hydroxyethyl)amino]quinoline-3-carboximidamide (PubChem CID 107480189) has the molecular formula C14H16F2N4O and a molecular weight of 294.31 g/mol. Its IUPAC name is 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]quinoline-3-carboximidamide.
| Compound Name | 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]quinoline-3-carboximidamide |
|---|---|
| PubChem CID | 107480189 |
| Molecular Formula | C14H16F2N4O |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.13 |
| IUPAC Name | 4-[2,2-difluoroethyl(2-hydroxyethyl)amino]quinoline-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1cnc2ccccc2c1N(CCO)CC(F)F |
| InChI | InChI=1S/C14H16F2N4O/c15-12(16)8-20(5-6-21)13-9-3-1-2-4-11(9)19-7-10(13)14(17)18/h1-4,7,12,21H,5-6,8H2,(H3,17,18) |
| InChIKey | CWDFPFXMCGMHNQ-UHFFFAOYSA-N |
| XLogP | 1.58 |
| TPSA | 86.23 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 1.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|