C17H22N4 — CID 61441744
4-[butyl(cyclopropyl)amino]quinoline-3-carboximidamide (PubChem CID 61441744) has the molecular formula C17H22N4 and a molecular weight of 282.39 g/mol. Its IUPAC name is 4-[butyl(cyclopropyl)amino]quinoline-3-carboximidamide.
| Compound Name | 4-[butyl(cyclopropyl)amino]quinoline-3-carboximidamide |
|---|---|
| PubChem CID | 61441744 |
| Molecular Formula | C17H22N4 |
| Molecular Weight | 282.39 g/mol |
| Exact Mass | 282.18 |
| IUPAC Name | 4-[butyl(cyclopropyl)amino]quinoline-3-carboximidamide |
| SMILES | [H]/N=C(\N)c1cnc2ccccc2c1N(CCCC)C1CC1 |
| InChI | InChI=1S/C17H22N4/c1-2-3-10-21(12-8-9-12)16-13-6-4-5-7-15(13)20-11-14(16)17(18)19/h4-7,11-12H,2-3,8-10H2,1H3,(H3,18,19) |
| InChIKey | IZXMGQCRLUUNKC-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 66.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.39 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|