C14H13N5OS — CID 43669930
N'-hydroxy-4-(1-methylimidazol-2-yl)sulfanylquinoline-3-carboximidamide (PubChem CID 43669930) has the molecular formula C14H13N5OS and a molecular weight of 299.36 g/mol. Its IUPAC name is N'-hydroxy-4-(1-methylimidazol-2-yl)sulfanylquinoline-3-carboximidamide.
| Compound Name | N'-hydroxy-4-(1-methylimidazol-2-yl)sulfanylquinoline-3-carboximidamide |
|---|---|
| PubChem CID | 43669930 |
| Molecular Formula | C14H13N5OS |
| Molecular Weight | 299.36 g/mol |
| Exact Mass | 299.08 |
| IUPAC Name | N'-hydroxy-4-(1-methylimidazol-2-yl)sulfanylquinoline-3-carboximidamide |
| SMILES | Cn1ccnc1Sc1c(/C(N)=N/O)cnc2ccccc12 |
| InChI | InChI=1S/C14H13N5OS/c1-19-7-6-16-14(19)21-12-9-4-2-3-5-11(9)17-8-10(12)13(15)18-20/h2-8,20H,1H3,(H2,15,18) |
| InChIKey | YQCXQFJRPOJEFF-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 89.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.36 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|