C13H12N6OS — CID 104603132
N'-hydroxy-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]quinoline-3-carboximidamide (PubChem CID 104603132) has the molecular formula C13H12N6OS and a molecular weight of 300.35 g/mol. Its IUPAC name is N'-hydroxy-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]quinoline-3-carboximidamide.
| Compound Name | N'-hydroxy-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]quinoline-3-carboximidamide |
|---|---|
| PubChem CID | 104603132 |
| Molecular Formula | C13H12N6OS |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.08 |
| IUPAC Name | N'-hydroxy-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanyl]quinoline-3-carboximidamide |
| SMILES | Cn1ncnc1Sc1c(/C(N)=N/O)cnc2ccccc12 |
| InChI | InChI=1S/C13H12N6OS/c1-19-13(16-7-17-19)21-11-8-4-2-3-5-10(8)15-6-9(11)12(14)18-20/h2-7,20H,1H3,(H2,14,18) |
| InChIKey | RMLWVSYGPDRULL-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|