C10H12N6OS — CID 136674901
N'-hydroxy-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]pyridine-2-carboximidamide (PubChem CID 136674901) has the molecular formula C10H12N6OS and a molecular weight of 264.31 g/mol. Its IUPAC name is N'-hydroxy-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]pyridine-2-carboximidamide.
| Compound Name | N'-hydroxy-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]pyridine-2-carboximidamide |
|---|---|
| PubChem CID | 136674901 |
| Molecular Formula | C10H12N6OS |
| Molecular Weight | 264.31 g/mol |
| Exact Mass | 264.08 |
| IUPAC Name | N'-hydroxy-4-[(2-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]pyridine-2-carboximidamide |
| SMILES | Cn1ncnc1SCc1ccnc(/C(N)=N/O)c1 |
| InChI | InChI=1S/C10H12N6OS/c1-16-10(13-6-14-16)18-5-7-2-3-12-8(4-7)9(11)15-17/h2-4,6,17H,5H2,1H3,(H2,11,15) |
| InChIKey | IVVRSWJFKOJAID-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 102.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.31 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|