C16H15BrN4 — CID 43673352
N-[(3-bromophenyl)methyl]-4-(1,2,4-triazol-1-ylmethyl)aniline (PubChem CID 43673352) has the molecular formula C16H15BrN4 and a molecular weight of 343.23 g/mol. Its IUPAC name is N-[(3-bromophenyl)methyl]-4-(1,2,4-triazol-1-ylmethyl)aniline.
| Compound Name | N-[(3-bromophenyl)methyl]-4-(1,2,4-triazol-1-ylmethyl)aniline |
|---|---|
| PubChem CID | 43673352 |
| Molecular Formula | C16H15BrN4 |
| Molecular Weight | 343.23 g/mol |
| Exact Mass | 342.05 |
| IUPAC Name | N-[(3-bromophenyl)methyl]-4-(1,2,4-triazol-1-ylmethyl)aniline |
| SMILES | Brc1cccc(CNc2ccc(Cn3cncn3)cc2)c1 |
| InChI | InChI=1S/C16H15BrN4/c17-15-3-1-2-14(8-15)9-19-16-6-4-13(5-7-16)10-21-12-18-11-20-21/h1-8,11-12,19H,9-10H2 |
| InChIKey | UBBIJAXSMCITML-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.23 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |