C18H27NO2 — CID 43673932
3-[(2-tert-butylcyclohexyl)amino]-2,3-dihydro-1-benzofuran-6-ol (PubChem CID 43673932) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is 3-[(2-tert-butylcyclohexyl)amino]-2,3-dihydro-1-benzofuran-6-ol.
| Compound Name | 3-[(2-tert-butylcyclohexyl)amino]-2,3-dihydro-1-benzofuran-6-ol |
|---|---|
| PubChem CID | 43673932 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | 3-[(2-tert-butylcyclohexyl)amino]-2,3-dihydro-1-benzofuran-6-ol |
| SMILES | CC(C)(C)C1CCCCC1NC1COc2cc(O)ccc21 |
| InChI | InChI=1S/C18H27NO2/c1-18(2,3)14-6-4-5-7-15(14)19-16-11-21-17-10-12(20)8-9-13(16)17/h8-10,14-16,19-20H,4-7,11H2,1-3H3 |
| InChIKey | GOMZIGNCRQJNIZ-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |