C12H15NO2 — CID 62416499
3-(cyclobutylamino)-2,3-dihydro-1-benzofuran-6-ol (PubChem CID 62416499) has the molecular formula C12H15NO2 and a molecular weight of 205.26 g/mol. Its IUPAC name is 3-(cyclobutylamino)-2,3-dihydro-1-benzofuran-6-ol.
| Compound Name | 3-(cyclobutylamino)-2,3-dihydro-1-benzofuran-6-ol |
|---|---|
| PubChem CID | 62416499 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 3-(cyclobutylamino)-2,3-dihydro-1-benzofuran-6-ol |
| SMILES | Oc1ccc2c(c1)OCC2NC1CCC1 |
| InChI | InChI=1S/C12H15NO2/c14-9-4-5-10-11(7-15-12(10)6-9)13-8-2-1-3-8/h4-6,8,11,13-14H,1-3,7H2 |
| InChIKey | HURJNMWEZKISAV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |