About 3-(cyclobutylamino)-2,3-dihydro-1-benzofuran-6-ol
3-(cyclobutylamino)-2,3-dihydro-1-benzofuran-6-ol (PubChem CID 62416499) has the molecular formula C12H15NO2
and a molecular weight of 205.26 g/mol. Its IUPAC name is 3-(cyclobutylamino)-2,3-dihydro-1-benzofuran-6-ol.
Molecular Properties
| Compound Name | 3-(cyclobutylamino)-2,3-dihydro-1-benzofuran-6-ol |
| PubChem CID | 62416499 |
| Molecular Formula | C12H15NO2 |
| Molecular Weight | 205.26 g/mol |
| Exact Mass | 205.11 |
| IUPAC Name | 3-(cyclobutylamino)-2,3-dihydro-1-benzofuran-6-ol |
| SMILES | Oc1ccc2c(c1)OCC2NC1CCC1 |
| InChI | InChI=1S/C12H15NO2/c14-9-4-5-10-11(7-15-12(10)6-9)13-8-2-1-3-8/h4-6,8,11,13-14H,1-3,7H2 |
| InChIKey | HURJNMWEZKISAV-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 205.26 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(cyclobutylamino)-2,3-dihydro-1-benzofuran-6-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(cyclobutylamino)-2,3-dihydro-1-benzofuran-6-ol?
The IUPAC name of 3-(cyclobutylamino)-2,3-dihydro-1-benzofuran-6-ol (CID 62416499) is 3-(cyclobutylamino)-2,3-dihydro-1-benzofuran-6-ol.
What is the SMILES notation for 3-(cyclobutylamino)-2,3-dihydro-1-benzofuran-6-ol?
The canonical SMILES for 3-(cyclobutylamino)-2,3-dihydro-1-benzofuran-6-ol is Oc1ccc2c(c1)OCC2NC1CCC1.
What is the InChIKey of 3-(cyclobutylamino)-2,3-dihydro-1-benzofuran-6-ol?
The InChIKey is HURJNMWEZKISAV-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15NO2/c14-9-4-5-10-11(7-15-12(10)6-9)13-8-2-1-3-8/h4-6,8,11,13-14H,1-3,7H2.
What are the key properties of 3-(cyclobutylamino)-2,3-dihydro-1-benzofuran-6-ol?
3-(cyclobutylamino)-2,3-dihydro-1-benzofuran-6-ol has a molecular weight of 205.26 g/mol, XLogP of 1.97, 2 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(cyclobutylamino)-2,3-dihydro-1-benzofuran-6-ol is sourced from PubChem (CID 62416499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).