C14H10ClN3O2S — CID 43674697
5-chloro-N-[(3-nitrophenyl)methyl]-1,3-benzothiazol-4-amine (PubChem CID 43674697) has the molecular formula C14H10ClN3O2S and a molecular weight of 319.77 g/mol. Its IUPAC name is 5-chloro-N-[(3-nitrophenyl)methyl]-1,3-benzothiazol-4-amine.
| Compound Name | 5-chloro-N-[(3-nitrophenyl)methyl]-1,3-benzothiazol-4-amine |
|---|---|
| PubChem CID | 43674697 |
| Molecular Formula | C14H10ClN3O2S |
| Molecular Weight | 319.77 g/mol |
| Exact Mass | 319.02 |
| IUPAC Name | 5-chloro-N-[(3-nitrophenyl)methyl]-1,3-benzothiazol-4-amine |
| SMILES | O=[N+]([O-])c1cccc(CNc2c(Cl)ccc3scnc23)c1 |
| InChI | InChI=1S/C14H10ClN3O2S/c15-11-4-5-12-14(17-8-21-12)13(11)16-7-9-2-1-3-10(6-9)18(19)20/h1-6,8,16H,7H2 |
| InChIKey | VPJTWDUNWHDEIU-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 68.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.77 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|