C14H8ClF3N2S — CID 63051536
5-chloro-N-[(3,4,5-trifluorophenyl)methyl]-1,3-benzothiazol-4-amine (PubChem CID 63051536) has the molecular formula C14H8ClF3N2S and a molecular weight of 328.75 g/mol. Its IUPAC name is 5-chloro-N-[(3,4,5-trifluorophenyl)methyl]-1,3-benzothiazol-4-amine.
| Compound Name | 5-chloro-N-[(3,4,5-trifluorophenyl)methyl]-1,3-benzothiazol-4-amine |
|---|---|
| PubChem CID | 63051536 |
| Molecular Formula | C14H8ClF3N2S |
| Molecular Weight | 328.75 g/mol |
| Exact Mass | 328.00 |
| IUPAC Name | 5-chloro-N-[(3,4,5-trifluorophenyl)methyl]-1,3-benzothiazol-4-amine |
| SMILES | Fc1cc(CNc2c(Cl)ccc3scnc23)cc(F)c1F |
| InChI | InChI=1S/C14H8ClF3N2S/c15-8-1-2-11-14(20-6-21-11)13(8)19-5-7-3-9(16)12(18)10(17)4-7/h1-4,6,19H,5H2 |
| InChIKey | YZQNSQRZLLTETM-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.75 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|