C14H17N3OS — CID 43675543
N-[2-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]thian-4-amine (PubChem CID 43675543) has the molecular formula C14H17N3OS and a molecular weight of 275.38 g/mol. Its IUPAC name is N-[2-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]thian-4-amine.
| Compound Name | N-[2-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]thian-4-amine |
|---|---|
| PubChem CID | 43675543 |
| Molecular Formula | C14H17N3OS |
| Molecular Weight | 275.38 g/mol |
| Exact Mass | 275.11 |
| IUPAC Name | N-[2-(5-methyl-1,3,4-oxadiazol-2-yl)phenyl]thian-4-amine |
| SMILES | Cc1nnc(-c2ccccc2NC2CCSCC2)o1 |
| InChI | InChI=1S/C14H17N3OS/c1-10-16-17-14(18-10)12-4-2-3-5-13(12)15-11-6-8-19-9-7-11/h2-5,11,15H,6-9H2,1H3 |
| InChIKey | KGSDFNHOILTFIB-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 50.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.38 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |