C15H21F3N2S — CID 43676666
1-propyl-N-[2-(trifluoromethylsulfanyl)phenyl]piperidin-4-amine (PubChem CID 43676666) has the molecular formula C15H21F3N2S and a molecular weight of 318.41 g/mol. Its IUPAC name is 1-propyl-N-[2-(trifluoromethylsulfanyl)phenyl]piperidin-4-amine.
| Compound Name | 1-propyl-N-[2-(trifluoromethylsulfanyl)phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 43676666 |
| Molecular Formula | C15H21F3N2S |
| Molecular Weight | 318.41 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | 1-propyl-N-[2-(trifluoromethylsulfanyl)phenyl]piperidin-4-amine |
| SMILES | CCCN1CCC(Nc2ccccc2SC(F)(F)F)CC1 |
| InChI | InChI=1S/C15H21F3N2S/c1-2-9-20-10-7-12(8-11-20)19-13-5-3-4-6-14(13)21-15(16,17)18/h3-6,12,19H,2,7-11H2,1H3 |
| InChIKey | BIQYLDLEKQMEGU-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.41 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |