C13H18N2O4S — CID 43679681
3-methyl-N-[1-(3-nitrophenyl)ethyl]-1,1-dioxothiolan-3-amine (PubChem CID 43679681) has the molecular formula C13H18N2O4S and a molecular weight of 298.36 g/mol. Its IUPAC name is 3-methyl-N-[1-(3-nitrophenyl)ethyl]-1,1-dioxothiolan-3-amine.
| Compound Name | 3-methyl-N-[1-(3-nitrophenyl)ethyl]-1,1-dioxothiolan-3-amine |
|---|---|
| PubChem CID | 43679681 |
| Molecular Formula | C13H18N2O4S |
| Molecular Weight | 298.36 g/mol |
| Exact Mass | 298.10 |
| IUPAC Name | 3-methyl-N-[1-(3-nitrophenyl)ethyl]-1,1-dioxothiolan-3-amine |
| SMILES | CC(NC1(C)CCS(=O)(=O)C1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C13H18N2O4S/c1-10(11-4-3-5-12(8-11)15(16)17)14-13(2)6-7-20(18,19)9-13/h3-5,8,10,14H,6-7,9H2,1-2H3 |
| InChIKey | OXKCISIYKHHQJT-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 89.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.36 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|