C12H12ClN3O2 — CID 43680666
methyl 4-chloro-2-(1H-pyrazol-5-ylmethylamino)benzoate (PubChem CID 43680666) has the molecular formula C12H12ClN3O2 and a molecular weight of 265.70 g/mol. Its IUPAC name is methyl 4-chloro-2-(1H-pyrazol-5-ylmethylamino)benzoate.
| Compound Name | methyl 4-chloro-2-(1H-pyrazol-5-ylmethylamino)benzoate |
|---|---|
| PubChem CID | 43680666 |
| Molecular Formula | C12H12ClN3O2 |
| Molecular Weight | 265.70 g/mol |
| Exact Mass | 265.06 |
| IUPAC Name | methyl 4-chloro-2-(1H-pyrazol-5-ylmethylamino)benzoate |
| SMILES | COC(=O)c1ccc(Cl)cc1NCc1ccn[nH]1 |
| InChI | InChI=1S/C12H12ClN3O2/c1-18-12(17)10-3-2-8(13)6-11(10)14-7-9-4-5-15-16-9/h2-6,14H,7H2,1H3,(H,15,16) |
| InChIKey | FEFCMAHKWIPFPL-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 67.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.70 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |