C14H21F2NO3S — CID 43683852
4-(difluoromethylsulfonyl)-N-(4-methoxy-4-methylpentan-2-yl)aniline (PubChem CID 43683852) has the molecular formula C14H21F2NO3S and a molecular weight of 321.39 g/mol. Its IUPAC name is 4-(difluoromethylsulfonyl)-N-(4-methoxy-4-methylpentan-2-yl)aniline.
| Compound Name | 4-(difluoromethylsulfonyl)-N-(4-methoxy-4-methylpentan-2-yl)aniline |
|---|---|
| PubChem CID | 43683852 |
| Molecular Formula | C14H21F2NO3S |
| Molecular Weight | 321.39 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | 4-(difluoromethylsulfonyl)-N-(4-methoxy-4-methylpentan-2-yl)aniline |
| SMILES | COC(C)(C)CC(C)Nc1ccc(S(=O)(=O)C(F)F)cc1 |
| InChI | InChI=1S/C14H21F2NO3S/c1-10(9-14(2,3)20-4)17-11-5-7-12(8-6-11)21(18,19)13(15)16/h5-8,10,13,17H,9H2,1-4H3 |
| InChIKey | GKCJOFUZKCPHGS-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |