C16H13F2NS — CID 43687757
N-[1-(2,6-difluorophenyl)ethyl]-1-benzothiophen-5-amine (PubChem CID 43687757) has the molecular formula C16H13F2NS and a molecular weight of 289.35 g/mol. Its IUPAC name is N-[1-(2,6-difluorophenyl)ethyl]-1-benzothiophen-5-amine.
| Compound Name | N-[1-(2,6-difluorophenyl)ethyl]-1-benzothiophen-5-amine |
|---|---|
| PubChem CID | 43687757 |
| Molecular Formula | C16H13F2NS |
| Molecular Weight | 289.35 g/mol |
| Exact Mass | 289.07 |
| IUPAC Name | N-[1-(2,6-difluorophenyl)ethyl]-1-benzothiophen-5-amine |
| SMILES | CC(Nc1ccc2sccc2c1)c1c(F)cccc1F |
| InChI | InChI=1S/C16H13F2NS/c1-10(16-13(17)3-2-4-14(16)18)19-12-5-6-15-11(9-12)7-8-20-15/h2-10,19H,1H3 |
| InChIKey | WUWGBOPVCSRVQR-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.35 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |